Nụ xuân hồng

Sáng tác: Đỗ Lễ | Nhạc Vàng | Điệu: Chưa chọn | kynguyen65 | 237

b [C] #
x2

Intro:[C][F]-[G][C]-[F][G][C]

1. [C] Em đẹp như màu hoa thắm [F] tươi hồng
[G] Cho tà áo vờn bay gió [C] xuân nồng
[C] Môi hồng như đào tơ mướt [F] non
[Dm] Một trời xuân đem bao nhiêu sắc thắm ôi huy hoàng
Tình nồng say êm như mơ [G] dưới nắng mai tươi [C] vàng
[G] Bàng hoàng trông em đang tha thướt hái hoa yêu [C kiều

ĐK : Với dáng tiên [C] mơ em hiện xuống lúc đêm [Dm] xuân
Ánh mắt long [G] lanh như ngập chiếu sáng lòng [C] anh
Suối tóc mơ [F] màng tô điểm giữa đám mây [G] xanh
Cho anh tình nồng bên em duyên dáng dịu [C] êm
Đôi tay ngọc [F] ngà nhẹ cầm những cánh hoa [G] mai
Tim em rộn ràng hứng lấy tương [C] lai
Môi em nở cười đón chúa xuân [F] về bên [C] lòng

2. [C] Em đẹp như hồng khoe sắc [F] muôn màu
[G] Anh lả lơi cười như bướm [C] đa tình
[C] Ôi nụ cười đẹp bao thắm [F] xinh
[Dm] Một mùa xuân tươi mát mang những nét son ngọc ngà
Đời mình như trong cơn mơ [G] thấy cõi tiên tuyệt [C] vời
[G] Một mùa xuân đem bao nhiêu nét phấn hương cho [C] đời


Hợp âm guitar sử dụng

Bài hát cùng thể loại
1. Bài thánh ca [D7] đó còn nhớ không [G] em [Bm] [Em] Noel năm [C] nào chúng mình có... 5974
1. Những đồi hoa [Am] sim ôi những đồi hoa [C] sim tím [Em] chiều hoang biền [Am] biệt Vào... 3946
Rumba 1. Ngược thời [Em] gian, trở về quá [G] khứ phút [Bm] giây chạnh [Em] lòng Bao nhiêu kỷ... 4228
1. Bạn bè xa [Am] nhau, chưa bao lần gặp [C] lại Kỷ niệm ngày [Dm] xưa, sao nói hết... 3026
1. Thành phố [Dm] nào nhớ không [F] em nơi chúng [Am] mình tìm phút êm [Dm] đềm Thành phố... 7553
Bài hát cùng tác giả
1. Thôi nín đi [Am] em lệ đẫm vai rồi, buồn thương nhớ ơi Em [A7] hỡi đôi [Dm] mình... 169953
Chuyện [Dm] tình mười mấy năm qua Nay bỗng xót [F] xa những khi sầu [A7] dâng Còn [Dm] đâu... 59935
1. Nói đi [Em] em câu chuyện buồn tình yêu Nói đi [Am] em vì mình thương quá [G] nhiều... 30850
Chuyện [Dm] tình nhuộm lắm thương đau Tủi [A7] hờn mang đến cho [F] nhau Vì [Gm] yêu khổ đau... 20017
1. Đường em [Em] đi đường xa vắng buồn đôi mắt nhìn [Am] nhau không nói một [Em] câu Chiều... 18110

Bình luận 1
demmauhong 2 tuần trước

Xin cám ơn bạn kynguyen65!

Nhập bình luận