Mộng tình vỡ đôi

Sáng tác: Diễm Trang | Nhạc Trữ tình | Điệu: Chưa chọn | kynguyen65 | 153

b [Am] #
x2

Intro: [Am][G][C]-[D][Am]-[F][G][C]-[E7][Am]-[D][Am]

1. Biết anh giàu [Am] sang mình không chung lối mộng
Để em ôm [C] hoài giấc mộng tình vỡ [Am] đôi
Thì thôi anh [G] ơi ta đôi đường đôi [F] ngã
Ước mộng chi [G] nhiều em đếm bước đơn [F] côi [E7]

2. Biết yêu là [Am] đau mà sao vẫn yêu nhiều
Để cho lòng [C] này càng [G] đau xót người [Am] ơi
Giờ này đôi [G] ta không chung đường chung [F] lối
Anh bước theo [G] người em [Em] nhỏ lệ [Am] sầu rơi [G][Am]

ĐK: Anh [F] ơi! Anh sống kiếp đơn [Am] côi
Còn [G] em sống bên [C] người, anh [Em] có buồn [Am] hay vui
Riêng [Dm] em ôm mối sầu vạn [C] lối
Em nghẹn [Em] lòng dứt [G] tình đành [Am] sao anh [G][Am]

3. Biết không còn [Am] thương lòng em cứ thẩn thờ
Cho đến bây [C] giờ em [G] mới chợt nhận [Am] ra
Thì thôi anh [G] ơi, ta không còn gì [F] nữa
Anh vui bên [G] người em [Em] mộng tình [Am] vỡ đôi [G][Am]


Hợp âm guitar sử dụng

Bài hát cùng thể loại
Phiên bản 1 - Ân Thiên Vỹ trình bày Intro: [Dm][C][F]-[Gm][Am][Dm]-[Bb][C]-[F][Am][Dm]-[Gm][Dm] 1. Không phải của [Dm] mình có tranh [Am]... 3139
1. Man mác chiều buông [Em] lơi dòng sông [Am] Lam xanh vời [Bm] vợi Sương giăng mờ chân [Em]... 18739
1. Nửa đời cay [E7] đắng ta tìm thấy [Am] nhau [A7] Nửa đời hư [Dm] ảo dối lừa thân... 3515
1. Người giặt áo bên [Am] sông, đời em cánh hoa giữa [D] dòng Nhìn con nước ngược [Dm] xuôi,... 8103
Một thời mộng [Em] mơ thương nhớ bao mong chờ Ngỡ [Bm] là đem hết chân tình anh [D] trao... 3099
Bài hát cùng tác giả
Intro: [Dm][Bb][C][F]-[Bb][C][F] [Gm][Dm]-[C][Am][Dm]-[Gm][Dm] 1. Ta chán chê miệng [Dm] đời lọc lừa dối trá điêu [F] ngoa Lời ngọt [Bb]... 563
Intro: [Am][G][C]-[D][Am]-[F][G][C]-[E7][Am]-[D][Am] 1. Biết anh giàu [Am] sang mình không chung lối mộng Để em ôm [C] hoài giấc mộng... 153
Intro: [C][D][Am]-[D][Am]-[Dm][Am]-[G][Em][Am]-[Em][Am] 1. Tôi đi giữa chợ [Am] đời đã hơn nữa đời [C] người Nếm mùi [Am] đời đắng... 147
Intro: [Am][C]-[F][A][Dm]-[G][C]-[G][E7][Am]-[D][Am] 1. Đêm cứ buồn tôi nằm nghĩ [Am] chuyện đời Buồn vì lòng người thay trắng [C] đổi... 100
Intro: [Em][C]-[A][Am][Em]-[D][Bm]-[D][Bm][Em]-[D][Em] 1. Mộng [Em] ước thôi vỡ tan [C] rồi Tìm [A] đâu những tháng ngày thần [Em] tiên... 71

Nhập bình luận